CAS 2116-82-7 is the registry number for Z-L-Lys(Z)-ONp. Offered by: Creative Peptides. Available pack sizes: 5g, 25g.
(4-nitrophenyl) (2S)-2,6-bis(phenylmethoxycarbonylamino)hexanoate (CAS 2116-82-7) is a chemical compound with the molecular formula C28H29N3O8 and a molecular weight of 535.5 g/mol. IUPAC name: (4-nitrophenyl) (2S)-2,6-bis(phenylmethoxycarbonylamino)hexanoate. InChIKey: DQKARZJTYUBTMX-VWLOTQADSA-N.
| Molecular formula | C28H29N3O8 |
|---|---|
| Molecular weight | 535.5 g/mol |
| IUPAC name | (4-nitrophenyl) (2S)-2,6-bis(phenylmethoxycarbonylamino)hexanoate |
| InChIKey | DQKARZJTYUBTMX-VWLOTQADSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCCCC[C@@H](C(=O)OC2=CC=C(C=C2)[N+](=O)[O-])NC(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)