CAS 21165-77-5 appears in our catalog under these names: Glibenclamide EP Impurity B (Glyburide USP Related Compound B), Glibenclamide EP Impurity B, Glyburide USP RC B,Glibenclamide EP Impurity B, Glibenclamide Impurity 2(Glibenclamide EP Impurity B), N-((4-(2-((5-Chloro-2-methoxybenzoyl)amino)ethyl)phenyl)sulfonyl)carbamic Acid Methyl Ester. Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol, Sigma-Aldrich. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Methyl N-[4-[2-[(5-chloro-2-methoxybenzoyl)amino]ethyl]phenyl]sulfonylcarbamate (CAS 21165-77-5) is a chemical compound with the molecular formula C18H19ClN2O6S and a molecular weight of 426.9 g/mol. IUPAC name: methyl N-[4-[2-[(5-chloro-2-methoxybenzoyl)amino]ethyl]phenyl]sulfonylcarbamate. InChIKey: FHUMMCKSSXULQH-UHFFFAOYSA-N.
| Molecular formula | C18H19ClN2O6S |
|---|---|
| Molecular weight | 426.9 g/mol |
| IUPAC name | methyl N-[4-[2-[(5-chloro-2-methoxybenzoyl)amino]ethyl]phenyl]sulfonylcarbamate |
| InChIKey | FHUMMCKSSXULQH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)Cl)C(=O)NCCC2=CC=C(C=C2)S(=O)(=O)NC(=O)OC |
Computed by PubChem (NCBI)