CAS 2116542-14-2 is the registry number for 4,4'-(9,9-Diethyl-9H-fluorene-2,7-diyl)dibenzaldehyde, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[9,9-diethyl-7-(4-formylphenyl)fluoren-2-yl]benzaldehyde (CAS 2116542-14-2) is a chemical compound with the molecular formula C31H26O2 and a molecular weight of 430.5 g/mol. IUPAC name: 4-[9,9-diethyl-7-(4-formylphenyl)fluoren-2-yl]benzaldehyde. InChIKey: QPZSZWAIHRMSGD-UHFFFAOYSA-N.
| Molecular formula | C31H26O2 |
|---|---|
| Molecular weight | 430.5 g/mol |
| IUPAC name | 4-[9,9-diethyl-7-(4-formylphenyl)fluoren-2-yl]benzaldehyde |
| InChIKey | QPZSZWAIHRMSGD-UHFFFAOYSA-N |
| SMILES | CCC1(C2=C(C=CC(=C2)C3=CC=C(C=C3)C=O)C4=C1C=C(C=C4)C5=CC=C(C=C5)C=O)CC |
Computed by PubChem (NCBI)