CAS 211693-76-4 is the registry number for 5-Chloro-3,4-difluorobenzene-1,2-diamine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 1g.
5-chloro-3,4-difluorobenzene-1,2-diamine (CAS 211693-76-4) is a chemical compound with the molecular formula C6H5ClF2N2 and a molecular weight of 178.57 g/mol. IUPAC name: 5-chloro-3,4-difluorobenzene-1,2-diamine. InChIKey: VZXRPPKNNXLMMK-UHFFFAOYSA-N.
| Molecular formula | C6H5ClF2N2 |
|---|---|
| Molecular weight | 178.57 g/mol |
| IUPAC name | 5-chloro-3,4-difluorobenzene-1,2-diamine |
| InChIKey | VZXRPPKNNXLMMK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Cl)F)F)N)N |
Computed by PubChem (NCBI)