CAS 2116940-92-0 appears in our catalog under these names: Ethyl 2,3-difluoro-4-(methylthio)benzoate, 95%, Ethyl 2,3-difluoro-4-(methylthio)benzoate. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 5g, 250mg, 1g.
Ethyl 2,3-difluoro-4-methylsulfanylbenzoate (CAS 2116940-92-0) is a chemical compound with the molecular formula C10H10F2O2S and a molecular weight of 232.25 g/mol. IUPAC name: ethyl 2,3-difluoro-4-methylsulfanylbenzoate. InChIKey: HRYZWGMLYHVFPP-UHFFFAOYSA-N.
| Molecular formula | C10H10F2O2S |
|---|---|
| Molecular weight | 232.25 g/mol |
| IUPAC name | ethyl 2,3-difluoro-4-methylsulfanylbenzoate |
| InChIKey | HRYZWGMLYHVFPP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=C(C=C1)SC)F)F |
Computed by PubChem (NCBI)