CAS 2117-24-0 appears in our catalog under these names: 1,4–bis(trimethylsiloxy)benzene, 1,4-Bis((trimethylsilyl)oxy)benzene 95%, 1,4-Bis((trimethylsilyl)oxy)benzene, 95%, 95%. Offered by: GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 5g, 10g.
Trimethyl-(4-trimethylsilyloxyphenoxy)silane (CAS 2117-24-0) is a chemical compound with the molecular formula C12H22O2Si2 and a molecular weight of 254.47 g/mol. IUPAC name: trimethyl-(4-trimethylsilyloxyphenoxy)silane. InChIKey: DVLYYIZODAWMML-UHFFFAOYSA-N.
| Molecular formula | C12H22O2Si2 |
|---|---|
| Molecular weight | 254.47 g/mol |
| IUPAC name | trimethyl-(4-trimethylsilyloxyphenoxy)silane |
| InChIKey | DVLYYIZODAWMML-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)OC1=CC=C(C=C1)O[Si](C)(C)C |
Computed by PubChem (NCBI)