Products 2117196-86-6
CAS 2117196-86-6 is the registry number for O1-tert-butyl O3-methyl 3-(trifluoromethyl)azetidine-1,3-dicarboxylate, >95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
1-O-tert-butyl 3-O-methyl 3-(trifluoromethyl)azetidine-1,3-dicarboxylate (CAS 2117196-86-6) is a chemical compound with the molecular formula C11H16F3NO4 and a molecular weight of 283.24 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl 3-(trifluoromethyl)azetidine-1,3-dicarboxylate. InChIKey: JSDJEBOSNNBSLH-UHFFFAOYSA-N.
| Molecular formula | C11H16F3NO4 |
|---|---|
| Molecular weight | 283.24 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl 3-(trifluoromethyl)azetidine-1,3-dicarboxylate |
| InChIKey | JSDJEBOSNNBSLH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)(C(=O)OC)C(F)(F)F |
Computed by PubChem (NCBI)