Products 2117619-05-1
CAS 2117619-05-1 is the registry number for Lumateperone Impurity 26. Offered by: Chemat Brand. Available pack sizes: on request.
(10R,15S)-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one (CAS 2117619-05-1) is a chemical compound with the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. IUPAC name: (10R,15S)-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one. InChIKey: AXAIIQDWKAKAKR-ONGXEEELSA-N.
| Molecular formula | C13H15N3O |
|---|---|
| Molecular weight | 229.28 g/mol |
| IUPAC name | (10R,15S)-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-3-one |
| InChIKey | AXAIIQDWKAKAKR-ONGXEEELSA-N |
| SMILES | C1CNC[C@@H]2[C@H]1N3CC(=O)NC4=CC=CC2=C43 |
Computed by PubChem (NCBI)