Products 379254-48-5
CAS 379254-48-5 is the registry number for 2,5-Dimethyl-1-phenyl-1h-pyrrole-3-carbohydrazide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2,5-dimethyl-1-phenylpyrrole-3-carbohydrazide (CAS 379254-48-5) is a chemical compound with the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. IUPAC name: 2,5-dimethyl-1-phenylpyrrole-3-carbohydrazide. InChIKey: JRXKLRZWUZJNHI-UHFFFAOYSA-N.
| Molecular formula | C13H15N3O |
|---|---|
| Molecular weight | 229.28 g/mol |
| IUPAC name | 2,5-dimethyl-1-phenylpyrrole-3-carbohydrazide |
| InChIKey | JRXKLRZWUZJNHI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1C2=CC=CC=C2)C)C(=O)NN |
Computed by PubChem (NCBI)