Products 2117645-10-8
CAS 2117645-10-8 is the registry number for HSP90-IN-31. Offered by: MedChemExpress. Available pack sizes: Get quote.
2,4-dihydroxy-N-methyl-5-propan-2-yl-N-[[4-(propylcarbamoyl)phenyl]methyl]benzamide (CAS 2117645-10-8) is a chemical compound with the molecular formula C22H28N2O4 and a molecular weight of 384.5 g/mol. IUPAC name: 2,4-dihydroxy-N-methyl-5-propan-2-yl-N-[[4-(propylcarbamoyl)phenyl]methyl]benzamide. InChIKey: FPLRZXZDCUKVAU-UHFFFAOYSA-N.
| Molecular formula | C22H28N2O4 |
|---|---|
| Molecular weight | 384.5 g/mol |
| IUPAC name | 2,4-dihydroxy-N-methyl-5-propan-2-yl-N-[[4-(propylcarbamoyl)phenyl]methyl]benzamide |
| InChIKey | FPLRZXZDCUKVAU-UHFFFAOYSA-N |
| SMILES | CCCNC(=O)C1=CC=C(C=C1)CN(C)C(=O)C2=C(C=C(C(=C2)C(C)C)O)O |
Computed by PubChem (NCBI)
Synonyms:
Hsp90-IN-30f, orb2646074