CAS 2117703-26-9 appears in our catalog under these names: Dacomitinib impurity 9, 95.67%, N4-(3,4-Difluorophenyl)-7-methoxyquinazoline-4,6-diamine (Dacomitinib Impurity), 95%. Offered by: MedChemExpress, Fluorochem. Available pack sizes: 5 mg, 25 mg, 50 mg, 10 mg, 50mg.
4-N-(3,4-difluorophenyl)-7-methoxyquinazoline-4,6-diamine (CAS 2117703-26-9) is a chemical compound with the molecular formula C15H12F2N4O and a molecular weight of 302.28 g/mol. IUPAC name: 4-N-(3,4-difluorophenyl)-7-methoxyquinazoline-4,6-diamine. InChIKey: GUVPDXOZKDIGIV-UHFFFAOYSA-N.
| Molecular formula | C15H12F2N4O |
|---|---|
| Molecular weight | 302.28 g/mol |
| IUPAC name | 4-N-(3,4-difluorophenyl)-7-methoxyquinazoline-4,6-diamine |
| InChIKey | GUVPDXOZKDIGIV-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)N=CN=C2NC3=CC(=C(C=C3)F)F)N |
Computed by PubChem (NCBI)