CAS 211914-50-0 appears in our catalog under these names: Dabigatran Impurity 73 HCl, Dabigatran Impurity 20, Dabigatran Etexilate Impurity L, Dabigatran Ethyl Ester Hydrochloride Salt, >95% (HPLC), Dabigatran-13C6 Ethyl Ester Hydrochloride Salt. Offered by: Chemat Brand, Hubei YoungXin, TRC, TargetMol, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, 5mg.
Ethyl 3-[[2-[(4-carbamimidoylanilino)methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate;hydrochloride (CAS 211914-50-0) is a chemical compound with the molecular formula C27H30ClN7O3 and a molecular weight of 536.0 g/mol. IUPAC name: ethyl 3-[[2-[(4-carbamimidoylanilino)methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate;hydrochloride. InChIKey: FHWBKCGBULSVFO-UHFFFAOYSA-N.
| Molecular formula | C27H30ClN7O3 |
|---|---|
| Molecular weight | 536.0 g/mol |
| IUPAC name | ethyl 3-[[2-[(4-carbamimidoylanilino)methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate;hydrochloride |
| InChIKey | FHWBKCGBULSVFO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCN(C1=CC=CC=N1)C(=O)C2=CC3=C(C=C2)N(C(=N3)CNC4=CC=C(C=C4)C(=N)N)C.Cl |
Computed by PubChem (NCBI)