CAS 2119563-11-8 is the registry number for 2-(3'-(Dibenzo(b,d)furan-4-yl)-(1,1'-biphenyl)-3-yl)-4,6-diphenyl-1,3,5-triazine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.
2-[3-(3-dibenzofuran-4-ylphenyl)phenyl]-4,6-diphenyl-1,3,5-triazine (CAS 2119563-11-8) is a chemical compound with the molecular formula C39H25N3O and a molecular weight of 551.6 g/mol. IUPAC name: 2-[3-(3-dibenzofuran-4-ylphenyl)phenyl]-4,6-diphenyl-1,3,5-triazine. InChIKey: KMDYECCXWFOSIL-UHFFFAOYSA-N.
| Molecular formula | C39H25N3O |
|---|---|
| Molecular weight | 551.6 g/mol |
| IUPAC name | 2-[3-(3-dibenzofuran-4-ylphenyl)phenyl]-4,6-diphenyl-1,3,5-triazine |
| InChIKey | KMDYECCXWFOSIL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC(=N2)C3=CC=CC(=C3)C4=CC(=CC=C4)C5=CC=CC6=C5OC7=CC=CC=C67)C8=CC=CC=C8 |
Computed by PubChem (NCBI)