Products 2120097-66-5

CAS 2120097-66-5 is the registry number for 1,2-Cyclohexane-d10-diamine (cis/trans mixture), 92 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,1g.

Structural formula: {0} (CAS {1})

1,2,3,3,4,4,5,5,6,6-decadeuteriocyclohexane-1,2-diamine (CAS 2120097-66-5) is a chemical compound with the molecular formula C6H14N2 and a molecular weight of 124.25 g/mol. IUPAC name: 1,2,3,3,4,4,5,5,6,6-decadeuteriocyclohexane-1,2-diamine. InChIKey: SSJXIUAHEKJCMH-MBXGXEIXSA-N.

Identity
Molecular formulaC6H14N2
Molecular weight124.25 g/mol
IUPAC name1,2,3,3,4,4,5,5,6,6-decadeuteriocyclohexane-1,2-diamine
InChIKeySSJXIUAHEKJCMH-MBXGXEIXSA-N
SMILES[2H]C1(C(C(C(C(C1([2H])[2H])([2H])N)([2H])N)([2H])[2H])([2H])[2H])[2H]

Computed by PubChem (NCBI)