CAS 21210-43-5 appears in our catalog under these names: Methyl (S)-(+)-Mandelate, Methyl (S)–(+)–mandelate, Methyl L-(+)-Mandelate, >98.0%(GC), (S)-Methyl 2-hydroxy-2-phenylacetate 98%, Methyl (S)-(+)-Mandelate, 98%, 98%. Offered by: TRC, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 25g, 50g, 5g, 100g, 500g, 1g, 1000g, 1kg.
Methyl (2S)-2-hydroxy-2-phenylacetate (CAS 21210-43-5) is a chemical compound with the molecular formula C9H10O3 and a molecular weight of 166.17 g/mol. IUPAC name: methyl (2S)-2-hydroxy-2-phenylacetate. InChIKey: ITATYELQCJRCCK-QMMMGPOBSA-N.
| Molecular formula | C9H10O3 |
|---|---|
| Molecular weight | 166.17 g/mol |
| IUPAC name | methyl (2S)-2-hydroxy-2-phenylacetate |
| InChIKey | ITATYELQCJRCCK-QMMMGPOBSA-N |
| SMILES | COC(=O)[C@H](C1=CC=CC=C1)O |
Computed by PubChem (NCBI)