Products 2121009-98-9
CAS 2121009-98-9 is the registry number for Methyl 3-(5-bromo-1H-indol-3-yl)-2,2-dimethylpropanoate, 95%. Offered by: BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 5g.
Methyl 3-(5-bromo-1H-indol-3-yl)-2,2-dimethylpropanoate (CAS 2121009-98-9) is a chemical compound with the molecular formula C14H16BrNO2 and a molecular weight of 310.19 g/mol. IUPAC name: methyl 3-(5-bromo-1H-indol-3-yl)-2,2-dimethylpropanoate. InChIKey: LFGNSSRFTBYVID-UHFFFAOYSA-N.
| Molecular formula | C14H16BrNO2 |
|---|---|
| Molecular weight | 310.19 g/mol |
| IUPAC name | methyl 3-(5-bromo-1H-indol-3-yl)-2,2-dimethylpropanoate |
| InChIKey | LFGNSSRFTBYVID-UHFFFAOYSA-N |
| SMILES | CC(C)(CC1=CNC2=C1C=C(C=C2)Br)C(=O)OC |
Computed by PubChem (NCBI)