CAS 21211-23-4 is the registry number for Methyl 3-chlorocinnamate 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-chloro-1,1-dioxo-1-benzothiophene-2-carboxylate (CAS 21211-23-4) is a chemical compound with the molecular formula C10H7ClO4S and a molecular weight of 258.68 g/mol. IUPAC name: methyl 3-chloro-1,1-dioxo-1-benzothiophene-2-carboxylate. InChIKey: XZEOEVIFVQYNGI-UHFFFAOYSA-N.
| Molecular formula | C10H7ClO4S |
|---|---|
| Molecular weight | 258.68 g/mol |
| IUPAC name | methyl 3-chloro-1,1-dioxo-1-benzothiophene-2-carboxylate |
| InChIKey | XZEOEVIFVQYNGI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=CC=CC=C2S1(=O)=O)Cl |
Computed by PubChem (NCBI)