CAS 212118-77-9 appears in our catalog under these names: FlAsH-EDT2, >95% (HPLC), FlAsH–EDT2, FlAsH-EDT2, FlAsH-EDT2, 99.0%, FlAsH-EDT2, 98%. Offered by: TRC, GLPBio, Biosynth, MedChemExpress, Fluorochem. Available pack sizes: 25mg, 50mg, 5mg, 1mg, 10mg, 50 mg, 10 mg, 5 mg.
4',5'-bis(1,3,2-dithiarsolan-2-yl)-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one (CAS 212118-77-9) is a chemical compound with the molecular formula C24H18As2O5S4 and a molecular weight of 664.5 g/mol. IUPAC name: 4',5'-bis(1,3,2-dithiarsolan-2-yl)-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one. InChIKey: AJNUQUGWNQHQDJ-UHFFFAOYSA-N.
| Molecular formula | C24H18As2O5S4 |
|---|---|
| Molecular weight | 664.5 g/mol |
| IUPAC name | 4',5'-bis(1,3,2-dithiarsolan-2-yl)-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
| InChIKey | AJNUQUGWNQHQDJ-UHFFFAOYSA-N |
| SMILES | C1CS[As](S1)C2=C(C=CC3=C2OC4=C(C35C6=CC=CC=C6C(=O)O5)C=CC(=C4[As]7SCCS7)O)O |
Computed by PubChem (NCBI)