CAS 212135-62-1 appears in our catalog under these names: ZT–1a, ZT-1a, 98%, ZT-1a/ 99.59% (existing batch purity), ZT-1a, ZT-1a, 99.87%. Offered by: GLPBio, AmBeed, TargetMol, Biosynth, Chemat. Available pack sizes: 1mg, 100mg, 5mg, 10mg, 25mg, 50mg, 10mM (in 1ml dmso), 10mM/1mL.
5-chloro-N-[5-chloro-4-[(4-chlorophenyl)-cyanomethyl]-2-methylphenyl]-2-hydroxybenzamide (CAS 212135-62-1) is a chemical compound with the molecular formula C22H15Cl3N2O2 and a molecular weight of 445.7 g/mol. IUPAC name: 5-chloro-N-[5-chloro-4-[(4-chlorophenyl)-cyanomethyl]-2-methylphenyl]-2-hydroxybenzamide. InChIKey: RPTKRVXJNWPJLU-UHFFFAOYSA-N.
| Molecular formula | C22H15Cl3N2O2 |
|---|---|
| Molecular weight | 445.7 g/mol |
| IUPAC name | 5-chloro-N-[5-chloro-4-[(4-chlorophenyl)-cyanomethyl]-2-methylphenyl]-2-hydroxybenzamide |
| InChIKey | RPTKRVXJNWPJLU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1NC(=O)C2=C(C=CC(=C2)Cl)O)Cl)C(C#N)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)