CAS 212141-52-1 is the registry number for Vatalanib (hydrochloride). Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(4-chlorophenyl)-4-(pyridin-4-ylmethyl)phthalazin-1-amine;hydrochloride (CAS 212141-52-1) is a chemical compound with the molecular formula C20H16Cl2N4 and a molecular weight of 383.3 g/mol. IUPAC name: N-(4-chlorophenyl)-4-(pyridin-4-ylmethyl)phthalazin-1-amine;hydrochloride. InChIKey: BDKWVFXIGVUEGA-UHFFFAOYSA-N.
| Molecular formula | C20H16Cl2N4 |
|---|---|
| Molecular weight | 383.3 g/mol |
| IUPAC name | N-(4-chlorophenyl)-4-(pyridin-4-ylmethyl)phthalazin-1-amine;hydrochloride |
| InChIKey | BDKWVFXIGVUEGA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NN=C2NC3=CC=C(C=C3)Cl)CC4=CC=NC=C4.Cl |
Computed by PubChem (NCBI)