CAS 2121511-43-9 is the registry number for 3-(N-Methylaminomethyl)-2-fluorophenylboronic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
[2-fluoro-3-(methylaminomethyl)phenyl]boronic acid (CAS 2121511-43-9) is a chemical compound with the molecular formula C8H11BFNO2 and a molecular weight of 182.99 g/mol. IUPAC name: [2-fluoro-3-(methylaminomethyl)phenyl]boronic acid. InChIKey: LQJCADUQSXQZOA-UHFFFAOYSA-N.
| Molecular formula | C8H11BFNO2 |
|---|---|
| Molecular weight | 182.99 g/mol |
| IUPAC name | [2-fluoro-3-(methylaminomethyl)phenyl]boronic acid |
| InChIKey | LQJCADUQSXQZOA-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)CNC)F)(O)O |
Computed by PubChem (NCBI)