CAS 2121511-59-7 appears in our catalog under these names: 5-Cyclopropyl-2-fluoropyridine-3-boronic acid, 95%, 2–Fluoro–5–(cyclopropyl)pyridine–3–boronic acid, 5-Cyclopropyl-2-fluoropyridine-3-boronic acid, ≥95%, ≥95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg, 25mg, 5mg.
(5-cyclopropyl-2-fluoro-3-pyridinyl)boronic acid (CAS 2121511-59-7) is a chemical compound with the molecular formula C8H9BFNO2 and a molecular weight of 180.97 g/mol. IUPAC name: (5-cyclopropyl-2-fluoro-3-pyridinyl)boronic acid. InChIKey: XNCUOEUFANNTBY-UHFFFAOYSA-N.
| Molecular formula | C8H9BFNO2 |
|---|---|
| Molecular weight | 180.97 g/mol |
| IUPAC name | (5-cyclopropyl-2-fluoro-3-pyridinyl)boronic acid |
| InChIKey | XNCUOEUFANNTBY-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CN=C1F)C2CC2)(O)O |
Computed by PubChem (NCBI)