CAS 2121511-61-1 appears in our catalog under these names: 5-Chloro-6-isopropoxynaphthalene-2-boronic acid, 95%, 5-Chloro-6-isopropoxynaphthalene-2-boronic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 500mg.
(5-chloro-6-propan-2-yloxynaphthalen-2-yl)boronic acid (CAS 2121511-61-1) is a chemical compound with the molecular formula C13H14BClO3 and a molecular weight of 264.51 g/mol. IUPAC name: (5-chloro-6-propan-2-yloxynaphthalen-2-yl)boronic acid. InChIKey: LYRSCYODVGZRCU-UHFFFAOYSA-N.
| Molecular formula | C13H14BClO3 |
|---|---|
| Molecular weight | 264.51 g/mol |
| IUPAC name | (5-chloro-6-propan-2-yloxynaphthalen-2-yl)boronic acid |
| InChIKey | LYRSCYODVGZRCU-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C(=C(C=C2)OC(C)C)Cl)(O)O |
Computed by PubChem (NCBI)