CAS 2121511-77-9 is the registry number for 5-Bromo-2-isopropoxypyridine-3-boronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
5-bromo-2-propan-2-yloxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 2121511-77-9) is a chemical compound with the molecular formula C14H21BBrNO3 and a molecular weight of 342.04 g/mol. IUPAC name: 5-bromo-2-propan-2-yloxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: OXMNKHBRESLSNV-UHFFFAOYSA-N.
| Molecular formula | C14H21BBrNO3 |
|---|---|
| Molecular weight | 342.04 g/mol |
| IUPAC name | 5-bromo-2-propan-2-yloxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | OXMNKHBRESLSNV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2OC(C)C)Br |
Computed by PubChem (NCBI)