CAS 2121511-86-0 is the registry number for 3-Bromo-2,6-dimethoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
3-bromo-2,6-dimethoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 2121511-86-0) is a chemical compound with the molecular formula C13H19BBrNO4 and a molecular weight of 344.01 g/mol. IUPAC name: 3-bromo-2,6-dimethoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: ZBNUFIJXZPMTSZ-UHFFFAOYSA-N.
| Molecular formula | C13H19BBrNO4 |
|---|---|
| Molecular weight | 344.01 g/mol |
| IUPAC name | 3-bromo-2,6-dimethoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | ZBNUFIJXZPMTSZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC(=C2Br)OC)OC |
Computed by PubChem (NCBI)