CAS 2121511-96-2 appears in our catalog under these names: 4-Chloro-2,3-difluoro-5-methoxyphenylboronic acid pinacol ester, 95%, 4-Chloro-2,3-difluoro-5-methoxyphenylboronic acid pinacol ester, ≥95%, ≥95%, 4-Chloro-2,3-difluoro-5-methoxyphenylboronic acid pinacol ester, ≥95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg.
2-(4-chloro-2,3-difluoro-5-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121511-96-2) is a chemical compound with the molecular formula C13H16BClF2O3 and a molecular weight of 304.53 g/mol. IUPAC name: 2-(4-chloro-2,3-difluoro-5-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: ZGSLZNVTHCWFNH-UHFFFAOYSA-N.
| Molecular formula | C13H16BClF2O3 |
|---|---|
| Molecular weight | 304.53 g/mol |
| IUPAC name | 2-(4-chloro-2,3-difluoro-5-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | ZGSLZNVTHCWFNH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2F)F)Cl)OC |
Computed by PubChem (NCBI)