CAS 2121512-26-1 is the registry number for 3,5-Dichloro-4-(methoxymethyl)phenylboronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
2-[3,5-dichloro-4-(methoxymethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121512-26-1) is a chemical compound with the molecular formula C14H19BCl2O3 and a molecular weight of 317.0 g/mol. IUPAC name: 2-[3,5-dichloro-4-(methoxymethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: CCSWESKFLCAJSP-UHFFFAOYSA-N.
| Molecular formula | C14H19BCl2O3 |
|---|---|
| Molecular weight | 317.0 g/mol |
| IUPAC name | 2-[3,5-dichloro-4-(methoxymethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | CCSWESKFLCAJSP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2)Cl)COC)Cl |
Computed by PubChem (NCBI)