CAS 2121512-54-5 is the registry number for 6-Bromo-2,3-dichlorophenylboronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
2-(6-bromo-2,3-dichlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121512-54-5) is a chemical compound with the molecular formula C12H14BBrCl2O2 and a molecular weight of 351.9 g/mol. IUPAC name: 2-(6-bromo-2,3-dichlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: XCNFWWZILSRYSR-UHFFFAOYSA-N.
| Molecular formula | C12H14BBrCl2O2 |
|---|---|
| Molecular weight | 351.9 g/mol |
| IUPAC name | 2-(6-bromo-2,3-dichlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | XCNFWWZILSRYSR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2Cl)Cl)Br |
Computed by PubChem (NCBI)