CAS 2121512-92-1 is the registry number for 4-Bromopyridine-3-boronic acid hbr, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
(4-bromo-3-pyridinyl)boronic acid;hydrobromide (CAS 2121512-92-1) is a chemical compound with the molecular formula C5H6BBr2NO2 and a molecular weight of 282.73 g/mol. IUPAC name: (4-bromo-3-pyridinyl)boronic acid;hydrobromide. InChIKey: WWBLWWAFEATIMV-UHFFFAOYSA-N.
| Molecular formula | C5H6BBr2NO2 |
|---|---|
| Molecular weight | 282.73 g/mol |
| IUPAC name | (4-bromo-3-pyridinyl)boronic acid;hydrobromide |
| InChIKey | WWBLWWAFEATIMV-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CN=C1)Br)(O)O.Br |
Computed by PubChem (NCBI)