CAS 2121512-99-8 appears in our catalog under these names: 5-Bromo-2,4-dimethoxyphenylboronic acid, pinacol ester, 95%, 5-Bromo-2,4-dimethoxyphenylboronic acid, pinacol ester, ≥95%, ≥95%, 2-(5-Bromo-2,4-dimethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
2-(5-bromo-2,4-dimethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121512-99-8) is a chemical compound with the molecular formula C14H20BBrO4 and a molecular weight of 343.02 g/mol. IUPAC name: 2-(5-bromo-2,4-dimethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: PZMHCUJQCLDWKR-UHFFFAOYSA-N.
| Molecular formula | C14H20BBrO4 |
|---|---|
| Molecular weight | 343.02 g/mol |
| IUPAC name | 2-(5-bromo-2,4-dimethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | PZMHCUJQCLDWKR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2OC)OC)Br |
Computed by PubChem (NCBI)