CAS 2121513-00-4 appears in our catalog under these names: 5-Bromo-2,3-difluoro-4-methylphenylboronic acid, 5-Bromo-2,3-difluoro-4-methylphenylboronic acid, 95%, (5-Bromo-2,3-difluoro-4-methylphenyl)boronic acid, 98%, 5-Bromo-2,3-difluoro-4-methylphenylboronic acid, ≥95%, ≥95%. Offered by: Fluorochem, Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 250mg.
(5-bromo-2,3-difluoro-4-methylphenyl)boronic acid (CAS 2121513-00-4) is a chemical compound with the molecular formula C7H6BBrF2O2 and a molecular weight of 250.84 g/mol. IUPAC name: (5-bromo-2,3-difluoro-4-methylphenyl)boronic acid. InChIKey: SRAYFRDQHIVSMN-UHFFFAOYSA-N.
| Molecular formula | C7H6BBrF2O2 |
|---|---|
| Molecular weight | 250.84 g/mol |
| IUPAC name | (5-bromo-2,3-difluoro-4-methylphenyl)boronic acid |
| InChIKey | SRAYFRDQHIVSMN-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1F)F)C)Br)(O)O |
Computed by PubChem (NCBI)