Products 2121513-40-2

CAS 2121513-40-2 is the registry number for 2-Fluoro-4-(methylthio)pyridine-3-boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

(2-fluoro-4-methylsulfanyl-3-pyridinyl)boronic acid (CAS 2121513-40-2) is a chemical compound with the molecular formula C6H7BFNO2S and a molecular weight of 187.00 g/mol. IUPAC name: (2-fluoro-4-methylsulfanyl-3-pyridinyl)boronic acid. InChIKey: NERKTEURAKIPPU-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7BFNO2S
Molecular weight187.00 g/mol
IUPAC name(2-fluoro-4-methylsulfanyl-3-pyridinyl)boronic acid
InChIKeyNERKTEURAKIPPU-UHFFFAOYSA-N
SMILESB(C1=C(C=CN=C1F)SC)(O)O

Computed by PubChem (NCBI)