CAS 2121513-73-1 appears in our catalog under these names: 3-Chloro-4-methyl-2-(methylthio)phenylboronic acid, 95%, (3-Chloro-4-methyl-2-(methylthio)phenyl)boronic acid, 98%, Boronic acid, B-[3-chloro-4-methyl-2-(methylthio)phenyl]-, ≥95%, ≥95%, 3-Chloro-4-methyl-2-(methylthio)phenylboronic acid, >=95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 250mg, 1g.
(3-chloro-4-methyl-2-methylsulfanylphenyl)boronic acid (CAS 2121513-73-1) is a chemical compound with the molecular formula C8H10BClO2S and a molecular weight of 216.50 g/mol. IUPAC name: (3-chloro-4-methyl-2-methylsulfanylphenyl)boronic acid. InChIKey: CDAQIJCJAQXBKW-UHFFFAOYSA-N.
| Molecular formula | C8H10BClO2S |
|---|---|
| Molecular weight | 216.50 g/mol |
| IUPAC name | (3-chloro-4-methyl-2-methylsulfanylphenyl)boronic acid |
| InChIKey | CDAQIJCJAQXBKW-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)C)Cl)SC)(O)O |
Computed by PubChem (NCBI)