CAS 2121513-94-6 appears in our catalog under these names: 4-Benzyloxy-2-chloropyrimidine-5-boronic acid, 95%, 4-Benzyloxy-2-Chloropyrimidine-5-Boronic acid, 4-Benzyloxy-2-chloropyrimidine-5-boronic acid, ≥95%, ≥95%, 4-Benzyloxy-2-chloropyrimidine-5-boronic acid, ≥95%. Offered by: Combi-blocks, TRC, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg, 750mg.
(2-chloro-4-phenylmethoxypyrimidin-5-yl)boronic acid (CAS 2121513-94-6) is a chemical compound with the molecular formula C11H10BClN2O3 and a molecular weight of 264.47 g/mol. IUPAC name: (2-chloro-4-phenylmethoxypyrimidin-5-yl)boronic acid. InChIKey: MLSBWOMQLKWUPG-UHFFFAOYSA-N.
| Molecular formula | C11H10BClN2O3 |
|---|---|
| Molecular weight | 264.47 g/mol |
| IUPAC name | (2-chloro-4-phenylmethoxypyrimidin-5-yl)boronic acid |
| InChIKey | MLSBWOMQLKWUPG-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(N=C1OCC2=CC=CC=C2)Cl)(O)O |
Computed by PubChem (NCBI)