CAS 2121514-12-1 is the registry number for 6-Bromo-2,3-dichloropyridine-4-boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
(6-bromo-2,3-dichloro-4-pyridinyl)boronic acid (CAS 2121514-12-1) is a chemical compound with the molecular formula C5H3BBrCl2NO2 and a molecular weight of 270.70 g/mol. IUPAC name: (6-bromo-2,3-dichloro-4-pyridinyl)boronic acid. InChIKey: FSCZKKSDEKZYJT-UHFFFAOYSA-N.
| Molecular formula | C5H3BBrCl2NO2 |
|---|---|
| Molecular weight | 270.70 g/mol |
| IUPAC name | (6-bromo-2,3-dichloro-4-pyridinyl)boronic acid |
| InChIKey | FSCZKKSDEKZYJT-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NC(=C1Cl)Cl)Br)(O)O |
Computed by PubChem (NCBI)