Products 2121514-12-1

CAS 2121514-12-1 is the registry number for 6-Bromo-2,3-dichloropyridine-4-boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

(6-bromo-2,3-dichloro-4-pyridinyl)boronic acid (CAS 2121514-12-1) is a chemical compound with the molecular formula C5H3BBrCl2NO2 and a molecular weight of 270.70 g/mol. IUPAC name: (6-bromo-2,3-dichloro-4-pyridinyl)boronic acid. InChIKey: FSCZKKSDEKZYJT-UHFFFAOYSA-N.

Identity
Molecular formulaC5H3BBrCl2NO2
Molecular weight270.70 g/mol
IUPAC name(6-bromo-2,3-dichloro-4-pyridinyl)boronic acid
InChIKeyFSCZKKSDEKZYJT-UHFFFAOYSA-N
SMILESB(C1=CC(=NC(=C1Cl)Cl)Br)(O)O

Computed by PubChem (NCBI)