CAS 2121514-15-4 is the registry number for 3-[4-(Trifluoromethoxy)phenyl]-pyridine-5-boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
[5-[4-(trifluoromethoxy)phenyl]-3-pyridinyl]boronic acid (CAS 2121514-15-4) is a chemical compound with the molecular formula C12H9BF3NO3 and a molecular weight of 283.01 g/mol. IUPAC name: [5-[4-(trifluoromethoxy)phenyl]-3-pyridinyl]boronic acid. InChIKey: OFPZCXPIRJJEGC-UHFFFAOYSA-N.
| Molecular formula | C12H9BF3NO3 |
|---|---|
| Molecular weight | 283.01 g/mol |
| IUPAC name | [5-[4-(trifluoromethoxy)phenyl]-3-pyridinyl]boronic acid |
| InChIKey | OFPZCXPIRJJEGC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CN=C1)C2=CC=C(C=C2)OC(F)(F)F)(O)O |
Computed by PubChem (NCBI)