Products 2121514-15-4

CAS 2121514-15-4 is the registry number for 3-[4-(Trifluoromethoxy)phenyl]-pyridine-5-boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

[5-[4-(trifluoromethoxy)phenyl]-3-pyridinyl]boronic acid (CAS 2121514-15-4) is a chemical compound with the molecular formula C12H9BF3NO3 and a molecular weight of 283.01 g/mol. IUPAC name: [5-[4-(trifluoromethoxy)phenyl]-3-pyridinyl]boronic acid. InChIKey: OFPZCXPIRJJEGC-UHFFFAOYSA-N.

Identity
Molecular formulaC12H9BF3NO3
Molecular weight283.01 g/mol
IUPAC name[5-[4-(trifluoromethoxy)phenyl]-3-pyridinyl]boronic acid
InChIKeyOFPZCXPIRJJEGC-UHFFFAOYSA-N
SMILESB(C1=CC(=CN=C1)C2=CC=C(C=C2)OC(F)(F)F)(O)O

Computed by PubChem (NCBI)