CAS 2121514-35-8 appears in our catalog under these names: 5-Bromo-3-(n,n-diethylaminocarbonyl)phenylboronic acid, 95%, (3-Bromo-5-(diethylcarbamoyl)phenyl)boronic acid, 98%, Boronic acid, B-[3-bromo-5-[(diethylamino)carbonyl]phenyl]-, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
[3-bromo-5-(diethylcarbamoyl)phenyl]boronic acid (CAS 2121514-35-8) is a chemical compound with the molecular formula C11H15BBrNO3 and a molecular weight of 299.96 g/mol. IUPAC name: [3-bromo-5-(diethylcarbamoyl)phenyl]boronic acid. InChIKey: YZOPDAMWFWEQDM-UHFFFAOYSA-N.
| Molecular formula | C11H15BBrNO3 |
|---|---|
| Molecular weight | 299.96 g/mol |
| IUPAC name | [3-bromo-5-(diethylcarbamoyl)phenyl]boronic acid |
| InChIKey | YZOPDAMWFWEQDM-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)Br)C(=O)N(CC)CC)(O)O |
Computed by PubChem (NCBI)