CAS 2121514-50-7 appears in our catalog under these names: 4-Bromo-2-fluoro-3-iodophenylboronic acid, 95%, (4-Bromo-2-fluoro-3-iodophenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
(4-bromo-2-fluoro-3-iodophenyl)boronic acid (CAS 2121514-50-7) is a chemical compound with the molecular formula C6H4BBrFIO2 and a molecular weight of 344.71 g/mol. IUPAC name: (4-bromo-2-fluoro-3-iodophenyl)boronic acid. InChIKey: UVTARXAYZABXOI-UHFFFAOYSA-N.
| Molecular formula | C6H4BBrFIO2 |
|---|---|
| Molecular weight | 344.71 g/mol |
| IUPAC name | (4-bromo-2-fluoro-3-iodophenyl)boronic acid |
| InChIKey | UVTARXAYZABXOI-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)Br)I)F)(O)O |
Computed by PubChem (NCBI)