CAS 2121514-60-9 is the registry number for 5-Bromo-4-chloro-2,3-difluorophenylboronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
2-(5-bromo-4-chloro-2,3-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121514-60-9) is a chemical compound with the molecular formula C12H13BBrClF2O2 and a molecular weight of 353.40 g/mol. IUPAC name: 2-(5-bromo-4-chloro-2,3-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: KUASSSGHIPPODU-UHFFFAOYSA-N.
| Molecular formula | C12H13BBrClF2O2 |
|---|---|
| Molecular weight | 353.40 g/mol |
| IUPAC name | 2-(5-bromo-4-chloro-2,3-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | KUASSSGHIPPODU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2F)F)Cl)Br |
Computed by PubChem (NCBI)