CAS 2121514-65-4 appears in our catalog under these names: 4-Butoxy-2-fluorophenylboronic acid pinacol ester, 4-Butoxy-2-fluorophenylboronic acid pinacol ester, 95%, 2-(4-Butoxy-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98+%. Offered by: Fluorochem, Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 100g, 25g, 5g.
2-(4-butoxy-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121514-65-4) is a chemical compound with the molecular formula C16H24BFO3 and a molecular weight of 294.2 g/mol. IUPAC name: 2-(4-butoxy-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: IENICJNDWZRETK-UHFFFAOYSA-N.
| Molecular formula | C16H24BFO3 |
|---|---|
| Molecular weight | 294.2 g/mol |
| IUPAC name | 2-(4-butoxy-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | IENICJNDWZRETK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)OCCCC)F |
Computed by PubChem (NCBI)