Products 2121514-79-0

CAS 2121514-79-0 is the registry number for 2,3,4-Trichloropyridine-5-boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

(4,5,6-trichloro-3-pyridinyl)boronic acid (CAS 2121514-79-0) is a chemical compound with the molecular formula C5H3BCl3NO2 and a molecular weight of 226.3 g/mol. IUPAC name: (4,5,6-trichloro-3-pyridinyl)boronic acid. InChIKey: CYWRKRIJHLOCPP-UHFFFAOYSA-N.

Identity
Molecular formulaC5H3BCl3NO2
Molecular weight226.3 g/mol
IUPAC name(4,5,6-trichloro-3-pyridinyl)boronic acid
InChIKeyCYWRKRIJHLOCPP-UHFFFAOYSA-N
SMILESB(C1=CN=C(C(=C1Cl)Cl)Cl)(O)O

Computed by PubChem (NCBI)