CAS 2121514-79-0 is the registry number for 2,3,4-Trichloropyridine-5-boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
(4,5,6-trichloro-3-pyridinyl)boronic acid (CAS 2121514-79-0) is a chemical compound with the molecular formula C5H3BCl3NO2 and a molecular weight of 226.3 g/mol. IUPAC name: (4,5,6-trichloro-3-pyridinyl)boronic acid. InChIKey: CYWRKRIJHLOCPP-UHFFFAOYSA-N.
| Molecular formula | C5H3BCl3NO2 |
|---|---|
| Molecular weight | 226.3 g/mol |
| IUPAC name | (4,5,6-trichloro-3-pyridinyl)boronic acid |
| InChIKey | CYWRKRIJHLOCPP-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(C(=C1Cl)Cl)Cl)(O)O |
Computed by PubChem (NCBI)