CAS 2121514-92-7 is the registry number for 3,5-Difluoro-4-(methylthio)phenylboronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
2-(3,5-difluoro-4-methylsulfanylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121514-92-7) is a chemical compound with the molecular formula C13H17BF2O2S and a molecular weight of 286.1 g/mol. IUPAC name: 2-(3,5-difluoro-4-methylsulfanylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: LHXBVDBEZKVXBU-UHFFFAOYSA-N.
| Molecular formula | C13H17BF2O2S |
|---|---|
| Molecular weight | 286.1 g/mol |
| IUPAC name | 2-(3,5-difluoro-4-methylsulfanylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | LHXBVDBEZKVXBU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2)F)SC)F |
Computed by PubChem (NCBI)