CAS 2121515-06-6 appears in our catalog under these names: 5-Bromo-4-chloro-2,3-difluorophenylboronic acid, 95%, 5-Bromo-4-chloro-2,3-difluorophenylboronic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
(5-bromo-4-chloro-2,3-difluorophenyl)boronic acid (CAS 2121515-06-6) is a chemical compound with the molecular formula C6H3BBrClF2O2 and a molecular weight of 271.25 g/mol. IUPAC name: (5-bromo-4-chloro-2,3-difluorophenyl)boronic acid. InChIKey: YKDXSHZNLOMERW-UHFFFAOYSA-N.
| Molecular formula | C6H3BBrClF2O2 |
|---|---|
| Molecular weight | 271.25 g/mol |
| IUPAC name | (5-bromo-4-chloro-2,3-difluorophenyl)boronic acid |
| InChIKey | YKDXSHZNLOMERW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1F)F)Cl)Br)(O)O |
Computed by PubChem (NCBI)