CAS 2121515-09-9 appears in our catalog under these names: 4-Chloro-5-methyl-1,3-dihydro-2,1-benzoxaborol-1-ol, 95%, 4-Chloro-5-methyl-1,3-dihydro-2,1-benzoxaborol-1-ol, ≥95%, ≥95%, 4-Chloro-5-methyl-1,3-dihydro-2,1-benzoxaborol-1-ol. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
4-chloro-1-hydroxy-5-methyl-3H-2,1-benzoxaborole (CAS 2121515-09-9) is a chemical compound with the molecular formula C8H8BClO2 and a molecular weight of 182.41 g/mol. IUPAC name: 4-chloro-1-hydroxy-5-methyl-3H-2,1-benzoxaborole. InChIKey: CJQPJNUBLDLKOE-UHFFFAOYSA-N.
| Molecular formula | C8H8BClO2 |
|---|---|
| Molecular weight | 182.41 g/mol |
| IUPAC name | 4-chloro-1-hydroxy-5-methyl-3H-2,1-benzoxaborole |
| InChIKey | CJQPJNUBLDLKOE-UHFFFAOYSA-N |
| SMILES | B1(C2=C(CO1)C(=C(C=C2)C)Cl)O |
Computed by PubChem (NCBI)