Products 2121515-16-8
CAS 2121515-16-8 is the registry number for 2-Fluoro-5-(methoxymethoxy)-pyridin-4-ylboronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
2-fluoro-5-(methoxymethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 2121515-16-8) is a chemical compound with the molecular formula C13H19BFNO4 and a molecular weight of 283.11 g/mol. IUPAC name: 2-fluoro-5-(methoxymethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: LXUGPRMZTOWFQL-UHFFFAOYSA-N.
| Molecular formula | C13H19BFNO4 |
|---|---|
| Molecular weight | 283.11 g/mol |
| IUPAC name | 2-fluoro-5-(methoxymethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | LXUGPRMZTOWFQL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC=C2OCOC)F |
Computed by PubChem (NCBI)