CAS 2121515-18-0 appears in our catalog under these names: 5-Bromo-3-(n-methylaminocarbonyl)phenylboronic acid, 95%, (3-Bromo-5-(methylcarbamoyl)phenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 25g, 250mg, 1g.
[3-bromo-5-(methylcarbamoyl)phenyl]boronic acid (CAS 2121515-18-0) is a chemical compound with the molecular formula C8H9BBrNO3 and a molecular weight of 257.88 g/mol. IUPAC name: [3-bromo-5-(methylcarbamoyl)phenyl]boronic acid. InChIKey: OHDDEMWGXPFMHZ-UHFFFAOYSA-N.
| Molecular formula | C8H9BBrNO3 |
|---|---|
| Molecular weight | 257.88 g/mol |
| IUPAC name | [3-bromo-5-(methylcarbamoyl)phenyl]boronic acid |
| InChIKey | OHDDEMWGXPFMHZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)Br)C(=O)NC)(O)O |
Computed by PubChem (NCBI)