CAS 2121515-20-4 is the registry number for 5-Chloro-4-hydroxy-3-(trifluoromethyl)phenylboronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)phenol (CAS 2121515-20-4) is a chemical compound with the molecular formula C13H15BClF3O3 and a molecular weight of 322.52 g/mol. IUPAC name: 2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)phenol. InChIKey: YEYAEMZYDDNXKQ-UHFFFAOYSA-N.
| Molecular formula | C13H15BClF3O3 |
|---|---|
| Molecular weight | 322.52 g/mol |
| IUPAC name | 2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)phenol |
| InChIKey | YEYAEMZYDDNXKQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2)Cl)O)C(F)(F)F |
Computed by PubChem (NCBI)