CAS 2121515-23-7 is the registry number for 2-(3-(Benzyloxy)-4-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-(4-fluoro-3-phenylmethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121515-23-7) is a chemical compound with the molecular formula C19H22BFO3 and a molecular weight of 328.2 g/mol. IUPAC name: 2-(4-fluoro-3-phenylmethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: NAEFVCGSQYBEJN-UHFFFAOYSA-N.
| Molecular formula | C19H22BFO3 |
|---|---|
| Molecular weight | 328.2 g/mol |
| IUPAC name | 2-(4-fluoro-3-phenylmethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | NAEFVCGSQYBEJN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)F)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)