CAS 2122282-85-1 appears in our catalog under these names: 5-(t-Butyldimethylsilyloxymethyl)thiophen-3-boronic acid, 96%, (5-(((tert-Butyldimethylsilyl)oxy)methyl)thiophen-3-yl)boronic acid 97%, 5-(T-BUTYLDIMETHYLSILYLOXYMETHYL)THIOPHEN-3-BORONIC ACID, 97%, 97%, 5-(t-Butyldimethylsilyloxymethyl)thiophen-3-boronic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 25g.
[5-[[tert-butyl(dimethyl)silyl]oxymethyl]thiophen-3-yl]boronic acid (CAS 2122282-85-1) is a chemical compound with the molecular formula C11H21BO3SSi and a molecular weight of 272.25 g/mol. IUPAC name: [5-[[tert-butyl(dimethyl)silyl]oxymethyl]thiophen-3-yl]boronic acid. InChIKey: JANLOTPOEMISMG-UHFFFAOYSA-N.
| Molecular formula | C11H21BO3SSi |
|---|---|
| Molecular weight | 272.25 g/mol |
| IUPAC name | [5-[[tert-butyl(dimethyl)silyl]oxymethyl]thiophen-3-yl]boronic acid |
| InChIKey | JANLOTPOEMISMG-UHFFFAOYSA-N |
| SMILES | B(C1=CSC(=C1)CO[Si](C)(C)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)