CAS 2122830-91-3 appears in our catalog under these names: Flibanserin-d4, Flibanserin–d4–1, Flibanserin-d4-1, 99.28%. Offered by: Chemat Brand, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 25mg, 10mg, 5mg, 5 mg, 10 mg, 1 mg.
3-[1,1,2,2-tetradeuterio-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]-1H-benzimidazol-2-one (CAS 2122830-91-3) is a chemical compound with the molecular formula C20H21F3N4O and a molecular weight of 394.4 g/mol. IUPAC name: 3-[1,1,2,2-tetradeuterio-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]-1H-benzimidazol-2-one. InChIKey: PPRRDFIXUUSXRA-DOWAQSPRSA-N.
| Molecular formula | C20H21F3N4O |
|---|---|
| Molecular weight | 394.4 g/mol |
| IUPAC name | 3-[1,1,2,2-tetradeuterio-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]-1H-benzimidazol-2-one |
| InChIKey | PPRRDFIXUUSXRA-DOWAQSPRSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])N1C2=CC=CC=C2NC1=O)N3CCN(CC3)C4=CC=CC(=C4)C(F)(F)F |
Computed by PubChem (NCBI)